C27H28N6O5 — CID 140522268
[2-carbamimidoyl-5-[[(3-methoxy-5-methylphenyl)-[1-(2-methoxyphenyl)-5-oxo-4H-1,2,4-triazol-3-yl]methyl]amino]phenyl] acetate (PubChem CID 140522268) has the molecular formula C27H28N6O5 and a molecular weight of 516.56 g/mol. Its IUPAC name is [2-carbamimidoyl-5-[[(3-methoxy-5-methylphenyl)-[1-(2-methoxyphenyl)-5-oxo-4H-1,2,4-triazol-3-yl]methyl]amino]phenyl] acetate.
| Compound Name | [2-carbamimidoyl-5-[[(3-methoxy-5-methylphenyl)-[1-(2-methoxyphenyl)-5-oxo-4H-1,2,4-triazol-3-yl]methyl]amino]phenyl] acetate |
|---|---|
| PubChem CID | 140522268 |
| Molecular Formula | C27H28N6O5 |
| Molecular Weight | 516.56 g/mol |
| Exact Mass | 516.21 |
| IUPAC Name | [2-carbamimidoyl-5-[[(3-methoxy-5-methylphenyl)-[1-(2-methoxyphenyl)-5-oxo-4H-1,2,4-triazol-3-yl]methyl]amino]phenyl] acetate |
| SMILES | [H]/N=C(\N)c1ccc(NC(c2cc(C)cc(OC)c2)c2nn(-c3ccccc3OC)c(=O)[nH]2)cc1OC(C)=O |
| InChI | InChI=1S/C27H28N6O5/c1-15-11-17(13-19(12-15)36-3)24(30-18-9-10-20(25(28)29)23(14-18)38-16(2)34)26-31-27(35)33(32-26)21-7-5-6-8-22(21)37-4/h5-14,24,30H,1-4H3,(H3,28,29)(H,31,32,35) |
| InChIKey | MHSRZGJGJDHBDH-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 157.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.56 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|