C28H26F4N6O5 — CID 140522254
[2-carbamimidoyl-5-[[(3-ethoxy-2-fluoro-5-methylphenyl)-[1-(2-methoxyphenyl)-5-oxo-4H-1,2,4-triazol-3-yl]methyl]amino]phenyl] 2,2,2-trifluoroacetate (PubChem CID 140522254) has the molecular formula C28H26F4N6O5 and a molecular weight of 602.55 g/mol. Its IUPAC name is [2-carbamimidoyl-5-[[(3-ethoxy-2-fluoro-5-methylphenyl)-[1-(2-methoxyphenyl)-5-oxo-4H-1,2,4-triazol-3-yl]methyl]amino]phenyl] 2,2,2-trifluoroacetate.
| Compound Name | [2-carbamimidoyl-5-[[(3-ethoxy-2-fluoro-5-methylphenyl)-[1-(2-methoxyphenyl)-5-oxo-4H-1,2,4-triazol-3-yl]methyl]amino]phenyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 140522254 |
| Molecular Formula | C28H26F4N6O5 |
| Molecular Weight | 602.55 g/mol |
| Exact Mass | 602.19 |
| IUPAC Name | [2-carbamimidoyl-5-[[(3-ethoxy-2-fluoro-5-methylphenyl)-[1-(2-methoxyphenyl)-5-oxo-4H-1,2,4-triazol-3-yl]methyl]amino]phenyl] 2,2,2-trifluoroacetate |
| SMILES | [H]/N=C(\N)c1ccc(NC(c2nn(-c3ccccc3OC)c(=O)[nH]2)c2cc(C)cc(OCC)c2F)cc1OC(=O)C(F)(F)F |
| InChI | InChI=1S/C28H26F4N6O5/c1-4-42-21-12-14(2)11-17(22(21)29)23(25-36-27(40)38(37-25)18-7-5-6-8-19(18)41-3)35-15-9-10-16(24(33)34)20(13-15)43-26(39)28(30,31)32/h5-13,23,35H,4H2,1-3H3,(H3,33,34)(H,36,37,40) |
| InChIKey | TVYMDRZLMJIFAH-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 157.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.55 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|