C29H32N6O7 — CID 140522160
[2-carbamimidoyl-5-[[(S)-[3-methoxy-4-(2-methoxyethoxy)phenyl]-[1-(2-methoxyphenyl)-5-oxo-4H-1,2,4-triazol-3-yl]methyl]amino]phenyl] acetate (PubChem CID 140522160) has the molecular formula C29H32N6O7 and a molecular weight of 576.61 g/mol. Its IUPAC name is [2-carbamimidoyl-5-[[(S)-[3-methoxy-4-(2-methoxyethoxy)phenyl]-[1-(2-methoxyphenyl)-5-oxo-4H-1,2,4-triazol-3-yl]methyl]amino]phenyl] acetate.
| Compound Name | [2-carbamimidoyl-5-[[(S)-[3-methoxy-4-(2-methoxyethoxy)phenyl]-[1-(2-methoxyphenyl)-5-oxo-4H-1,2,4-triazol-3-yl]methyl]amino]phenyl] acetate |
|---|---|
| PubChem CID | 140522160 |
| Molecular Formula | C29H32N6O7 |
| Molecular Weight | 576.61 g/mol |
| Exact Mass | 576.23 |
| IUPAC Name | [2-carbamimidoyl-5-[[(S)-[3-methoxy-4-(2-methoxyethoxy)phenyl]-[1-(2-methoxyphenyl)-5-oxo-4H-1,2,4-triazol-3-yl]methyl]amino]phenyl] acetate |
| SMILES | [H]/N=C(\N)c1ccc(N[C@@H](c2ccc(OCCOC)c(OC)c2)c2nn(-c3ccccc3OC)c(=O)[nH]2)cc1OC(C)=O |
| InChI | InChI=1S/C29H32N6O7/c1-17(36)42-24-16-19(10-11-20(24)27(30)31)32-26(18-9-12-23(25(15-18)40-4)41-14-13-38-2)28-33-29(37)35(34-28)21-7-5-6-8-22(21)39-3/h5-12,15-16,26,32H,13-14H2,1-4H3,(H3,30,31)(H,33,34,37)/t26-/m0/s1 |
| InChIKey | LLWLNPNSCOUCHY-SANMLTNESA-N |
| XLogP | 3.01 |
| TPSA | 175.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.61 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|