C25H26N8O6 — CID 140522181
[2-carbamimidoyl-5-[[(5-oxo-1-pyridazin-3-yl-4H-1,2,4-triazol-3-yl)-(3,4,5-trimethoxyphenyl)methyl]amino]phenyl] acetate (PubChem CID 140522181) has the molecular formula C25H26N8O6 and a molecular weight of 534.53 g/mol. Its IUPAC name is [2-carbamimidoyl-5-[[(5-oxo-1-pyridazin-3-yl-4H-1,2,4-triazol-3-yl)-(3,4,5-trimethoxyphenyl)methyl]amino]phenyl] acetate.
| Compound Name | [2-carbamimidoyl-5-[[(5-oxo-1-pyridazin-3-yl-4H-1,2,4-triazol-3-yl)-(3,4,5-trimethoxyphenyl)methyl]amino]phenyl] acetate |
|---|---|
| PubChem CID | 140522181 |
| Molecular Formula | C25H26N8O6 |
| Molecular Weight | 534.53 g/mol |
| Exact Mass | 534.20 |
| IUPAC Name | [2-carbamimidoyl-5-[[(5-oxo-1-pyridazin-3-yl-4H-1,2,4-triazol-3-yl)-(3,4,5-trimethoxyphenyl)methyl]amino]phenyl] acetate |
| SMILES | [H]/N=C(\N)c1ccc(NC(c2cc(OC)c(OC)c(OC)c2)c2nn(-c3cccnn3)c(=O)[nH]2)cc1OC(C)=O |
| InChI | InChI=1S/C25H26N8O6/c1-13(34)39-17-12-15(7-8-16(17)23(26)27)29-21(14-10-18(36-2)22(38-4)19(11-14)37-3)24-30-25(35)33(32-24)20-6-5-9-28-31-20/h5-12,21,29H,1-4H3,(H3,26,27)(H,30,32,35) |
| InChIKey | GYEYTSIDTZPWPT-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 192.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.53 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|