C24H29N5O — CID 136611770
azepan-1-yl-[1-methyl-3-[2-[(1Z,3Z)-3-methylpenta-1,3-dienyl]-1H-imidazol-5-yl]indazol-6-yl]methanone (PubChem CID 136611770) has the molecular formula C24H29N5O and a molecular weight of 403.53 g/mol. Its IUPAC name is azepan-1-yl-[1-methyl-3-[2-[(1Z,3Z)-3-methylpenta-1,3-dienyl]-1H-imidazol-5-yl]indazol-6-yl]methanone.
| Compound Name | azepan-1-yl-[1-methyl-3-[2-[(1Z,3Z)-3-methylpenta-1,3-dienyl]-1H-imidazol-5-yl]indazol-6-yl]methanone |
|---|---|
| PubChem CID | 136611770 |
| Molecular Formula | C24H29N5O |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.24 |
| IUPAC Name | azepan-1-yl-[1-methyl-3-[2-[(1Z,3Z)-3-methylpenta-1,3-dienyl]-1H-imidazol-5-yl]indazol-6-yl]methanone |
| SMILES | C/C=C(C)\C=C/c1ncc(-c2nn(C)c3cc(C(=O)N4CCCCCC4)ccc23)[nH]1 |
| InChI | InChI=1S/C24H29N5O/c1-4-17(2)9-12-22-25-16-20(26-22)23-19-11-10-18(15-21(19)28(3)27-23)24(30)29-13-7-5-6-8-14-29/h4,9-12,15-16H,5-8,13-14H2,1-3H3,(H,25,26)/b12-9-,17-4- |
| InChIKey | ICHFUVBZJQGECC-ZDIPGHHASA-N |
| XLogP | 4.96 |
| TPSA | 66.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|