C20H13Cl2N3O — CID 1366169
2-(2,4-dichlorophenyl)-3-(6-methyl-2-pyridinyl)quinazolin-4-one (PubChem CID 1366169) has the molecular formula C20H13Cl2N3O and a molecular weight of 382.25 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-3-(6-methyl-2-pyridinyl)quinazolin-4-one.
| Compound Name | 2-(2,4-dichlorophenyl)-3-(6-methyl-2-pyridinyl)quinazolin-4-one |
|---|---|
| PubChem CID | 1366169 |
| Molecular Formula | C20H13Cl2N3O |
| Molecular Weight | 382.25 g/mol |
| Exact Mass | 381.04 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-3-(6-methyl-2-pyridinyl)quinazolin-4-one |
| SMILES | Cc1cccc(-n2c(-c3ccc(Cl)cc3Cl)nc3ccccc3c2=O)n1 |
| InChI | InChI=1S/C20H13Cl2N3O/c1-12-5-4-8-18(23-12)25-19(14-10-9-13(21)11-16(14)22)24-17-7-3-2-6-15(17)20(25)26/h2-11H,1H3 |
| InChIKey | RMONRTSEABTKLE-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.25 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |