C25H20N4O3 — CID 94589126
2-[(1S)-1-[3-(6-methyl-2-pyridinyl)-4-oxoquinazolin-2-yl]propyl]isoindole-1,3-dione (PubChem CID 94589126) has the molecular formula C25H20N4O3 and a molecular weight of 424.46 g/mol. Its IUPAC name is 2-[(1S)-1-[3-(6-methyl-2-pyridinyl)-4-oxoquinazolin-2-yl]propyl]isoindole-1,3-dione.
| Compound Name | 2-[(1S)-1-[3-(6-methyl-2-pyridinyl)-4-oxoquinazolin-2-yl]propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 94589126 |
| Molecular Formula | C25H20N4O3 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | 2-[(1S)-1-[3-(6-methyl-2-pyridinyl)-4-oxoquinazolin-2-yl]propyl]isoindole-1,3-dione |
| SMILES | CC[C@@H](c1nc2ccccc2c(=O)n1-c1cccc(C)n1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C25H20N4O3/c1-3-20(28-23(30)16-10-4-5-11-17(16)24(28)31)22-27-19-13-7-6-12-18(19)25(32)29(22)21-14-8-9-15(2)26-21/h4-14,20H,3H2,1-2H3/t20-/m0/s1 |
| InChIKey | IAFREGNMSGFVQL-FQEVSTJZSA-N |
| XLogP | 3.84 |
| TPSA | 85.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|