C26H18F3N3O3 — CID 2972435
2-[1-[4-oxo-3-[3-(trifluoromethyl)phenyl]quinazolin-2-yl]propyl]isoindole-1,3-dione (PubChem CID 2972435) has the molecular formula C26H18F3N3O3 and a molecular weight of 477.44 g/mol. Its IUPAC name is 2-[1-[4-oxo-3-[3-(trifluoromethyl)phenyl]quinazolin-2-yl]propyl]isoindole-1,3-dione.
| Compound Name | 2-[1-[4-oxo-3-[3-(trifluoromethyl)phenyl]quinazolin-2-yl]propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 2972435 |
| Molecular Formula | C26H18F3N3O3 |
| Molecular Weight | 477.44 g/mol |
| Exact Mass | 477.13 |
| IUPAC Name | 2-[1-[4-oxo-3-[3-(trifluoromethyl)phenyl]quinazolin-2-yl]propyl]isoindole-1,3-dione |
| SMILES | CCC(c1nc2ccccc2c(=O)n1-c1cccc(C(F)(F)F)c1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C26H18F3N3O3/c1-2-21(32-23(33)17-10-3-4-11-18(17)24(32)34)22-30-20-13-6-5-12-19(20)25(35)31(22)16-9-7-8-15(14-16)26(27,28)29/h3-14,21H,2H2,1H3 |
| InChIKey | IZSPZQQPILVGQT-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.44 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|