C25H22Cl2N2O4 — CID 2299298
2-(2,4-dichlorophenyl)-3-[2-[2-(2-methoxyphenoxy)ethoxy]ethyl]quinazolin-4-one (PubChem CID 2299298) has the molecular formula C25H22Cl2N2O4 and a molecular weight of 485.37 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-3-[2-[2-(2-methoxyphenoxy)ethoxy]ethyl]quinazolin-4-one.
| Compound Name | 2-(2,4-dichlorophenyl)-3-[2-[2-(2-methoxyphenoxy)ethoxy]ethyl]quinazolin-4-one |
|---|---|
| PubChem CID | 2299298 |
| Molecular Formula | C25H22Cl2N2O4 |
| Molecular Weight | 485.37 g/mol |
| Exact Mass | 484.10 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-3-[2-[2-(2-methoxyphenoxy)ethoxy]ethyl]quinazolin-4-one |
| SMILES | COc1ccccc1OCCOCCn1c(-c2ccc(Cl)cc2Cl)nc2ccccc2c1=O |
| InChI | InChI=1S/C25H22Cl2N2O4/c1-31-22-8-4-5-9-23(22)33-15-14-32-13-12-29-24(18-11-10-17(26)16-20(18)27)28-21-7-3-2-6-19(21)25(29)30/h2-11,16H,12-15H2,1H3 |
| InChIKey | LSCLVCZUGNXKRP-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.37 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|