C21H23ClN4O6S — CID 136617860
2-[4-(6-amino-5-chloropyridin-1-ium-3-yl)phenyl]-N-[3-(3-methyloxetan-3-yl)-1,2-oxazol-5-yl]acetamide;methanesulfonate (PubChem CID 136617860) has the molecular formula C21H23ClN4O6S and a molecular weight of 494.96 g/mol. Its IUPAC name is 2-[4-(6-amino-5-chloropyridin-1-ium-3-yl)phenyl]-N-[3-(3-methyloxetan-3-yl)-1,2-oxazol-5-yl]acetamide;methanesulfonate.
| Compound Name | 2-[4-(6-amino-5-chloropyridin-1-ium-3-yl)phenyl]-N-[3-(3-methyloxetan-3-yl)-1,2-oxazol-5-yl]acetamide;methanesulfonate |
|---|---|
| PubChem CID | 136617860 |
| Molecular Formula | C21H23ClN4O6S |
| Molecular Weight | 494.96 g/mol |
| Exact Mass | 494.10 |
| IUPAC Name | 2-[4-(6-amino-5-chloropyridin-1-ium-3-yl)phenyl]-N-[3-(3-methyloxetan-3-yl)-1,2-oxazol-5-yl]acetamide;methanesulfonate |
| SMILES | CC1(c2cc(NC(=O)Cc3ccc(-c4c[nH+]c(N)c(Cl)c4)cc3)on2)COC1.CS(=O)(=O)[O-] |
| InChI | InChI=1S/C20H19ClN4O3.CH4O3S/c1-20(10-27-11-20)16-8-18(28-25-16)24-17(26)6-12-2-4-13(5-3-12)14-7-15(21)19(22)23-9-14;1-5(2,3)4/h2-5,7-9H,6,10-11H2,1H3,(H2,22,23)(H,24,26);1H3,(H,2,3,4) |
| InChIKey | FPDVVQNKNNSRLM-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 161.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.96 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|