C28H30N6O5 — CID 136619321
1'-(3-cyclopropyl-7-ethoxy-1,2-benzoxazole-5-carbonyl)-6-[1-[(2Z)-2-hydrazinylidenehydrazinyl]ethenyl]spiro[3H-chromene-2,4'-piperidine]-4-one (PubChem CID 136619321) has the molecular formula C28H30N6O5 and a molecular weight of 530.59 g/mol. Its IUPAC name is 1'-(3-cyclopropyl-7-ethoxy-1,2-benzoxazole-5-carbonyl)-6-[1-[(2Z)-2-hydrazinylidenehydrazinyl]ethenyl]spiro[3H-chromene-2,4'-piperidine]-4-one.
| Compound Name | 1'-(3-cyclopropyl-7-ethoxy-1,2-benzoxazole-5-carbonyl)-6-[1-[(2Z)-2-hydrazinylidenehydrazinyl]ethenyl]spiro[3H-chromene-2,4'-piperidine]-4-one |
|---|---|
| PubChem CID | 136619321 |
| Molecular Formula | C28H30N6O5 |
| Molecular Weight | 530.59 g/mol |
| Exact Mass | 530.23 |
| IUPAC Name | 1'-(3-cyclopropyl-7-ethoxy-1,2-benzoxazole-5-carbonyl)-6-[1-[(2Z)-2-hydrazinylidenehydrazinyl]ethenyl]spiro[3H-chromene-2,4'-piperidine]-4-one |
| SMILES | C=C(N/N=N\N)c1ccc2c(c1)C(=O)CC1(CCN(C(=O)c3cc(OCC)c4onc(C5CC5)c4c3)CC1)O2 |
| InChI | InChI=1S/C28H30N6O5/c1-3-37-24-14-19(13-21-25(17-4-5-17)31-39-26(21)24)27(36)34-10-8-28(9-11-34)15-22(35)20-12-18(6-7-23(20)38-28)16(2)30-33-32-29/h6-7,12-14,17H,2-5,8-11,15H2,1H3,(H2,29,33)(H,30,32) |
| InChIKey | BEZFLMUPLZGURS-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 144.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.59 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|