C9H15N3OS — CID 136622538
(NE,R)-2-methyl-N-[(5-methyl-1H-pyrazol-4-yl)methylidene]propane-2-sulfinamide (PubChem CID 136622538) has the molecular formula C9H15N3OS and a molecular weight of 213.31 g/mol. Its IUPAC name is (NE,R)-2-methyl-N-[(5-methyl-1H-pyrazol-4-yl)methylidene]propane-2-sulfinamide.
| Compound Name | (NE,R)-2-methyl-N-[(5-methyl-1H-pyrazol-4-yl)methylidene]propane-2-sulfinamide |
|---|---|
| PubChem CID | 136622538 |
| Molecular Formula | C9H15N3OS |
| Molecular Weight | 213.31 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | (NE,R)-2-methyl-N-[(5-methyl-1H-pyrazol-4-yl)methylidene]propane-2-sulfinamide |
| SMILES | Cc1[nH]ncc1/C=N/[S@](=O)C(C)(C)C |
| InChI | InChI=1S/C9H15N3OS/c1-7-8(5-10-12-7)6-11-14(13)9(2,3)4/h5-6H,1-4H3,(H,10,12)/b11-6+/t14-/m1/s1 |
| InChIKey | SGMRADNZPJGFBY-JBNJFFQFSA-N |
| XLogP | 1.60 |
| TPSA | 58.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.31 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|