C8H12N2OS2 — CID 172744712
(R)-2-methyl-N-(1,3-thiazol-5-ylmethylidene)propane-2-sulfinamide (PubChem CID 172744712) has the molecular formula C8H12N2OS2 and a molecular weight of 216.33 g/mol. Its IUPAC name is (R)-2-methyl-N-(1,3-thiazol-5-ylmethylidene)propane-2-sulfinamide.
| Compound Name | (R)-2-methyl-N-(1,3-thiazol-5-ylmethylidene)propane-2-sulfinamide |
|---|---|
| PubChem CID | 172744712 |
| Molecular Formula | C8H12N2OS2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.04 |
| IUPAC Name | (R)-2-methyl-N-(1,3-thiazol-5-ylmethylidene)propane-2-sulfinamide |
| SMILES | CC(C)(C)[S@@](=O)N=Cc1cncs1 |
| InChI | InChI=1S/C8H12N2OS2/c1-8(2,3)13(11)10-5-7-4-9-6-12-7/h4-6H,1-3H3/t13-/m1/s1 |
| InChIKey | JOKAZDLCQSIQQU-CYBMUJFWSA-N |
| XLogP | 2.02 |
| TPSA | 42.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|