C24H18ClF2N3O5 — CID 136625856
(3R,3aR,6R,6aR)-6-[[6-chloro-5-[4-(3,5-difluoro-2-hydroxyphenyl)phenyl]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol (PubChem CID 136625856) has the molecular formula C24H18ClF2N3O5 and a molecular weight of 501.87 g/mol. Its IUPAC name is (3R,3aR,6R,6aR)-6-[[6-chloro-5-[4-(3,5-difluoro-2-hydroxyphenyl)phenyl]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol.
| Compound Name | (3R,3aR,6R,6aR)-6-[[6-chloro-5-[4-(3,5-difluoro-2-hydroxyphenyl)phenyl]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
|---|---|
| PubChem CID | 136625856 |
| Molecular Formula | C24H18ClF2N3O5 |
| Molecular Weight | 501.87 g/mol |
| Exact Mass | 501.09 |
| IUPAC Name | (3R,3aR,6R,6aR)-6-[[6-chloro-5-[4-(3,5-difluoro-2-hydroxyphenyl)phenyl]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
| SMILES | Oc1c(F)cc(F)cc1-c1ccc(-c2nc3nc(O[C@@H]4CO[C@H]5[C@@H]4OC[C@H]5O)[nH]c3cc2Cl)cc1 |
| InChI | InChI=1S/C24H18ClF2N3O5/c25-14-7-16-23(30-24(28-16)35-18-9-34-21-17(31)8-33-22(18)21)29-19(14)11-3-1-10(2-4-11)13-5-12(26)6-15(27)20(13)32/h1-7,17-18,21-22,31-32H,8-9H2,(H,28,29,30)/t17-,18-,21-,22-/m1/s1 |
| InChIKey | BDSBWASMDXLCLQ-MCEIDBOGSA-N |
| XLogP | 3.84 |
| TPSA | 109.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.87 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |