C25H27ClN6O3S — CID 136628325
3-[[(6-chloro-3-pyridinyl)methylamino]-(4-methoxyphenyl)sulfinylmethylidene]-4-imino-1-methyl-5a,6,7,8,9,9a-hexahydropyrimido[1,2-a]benzimidazol-2-one (PubChem CID 136628325) has the molecular formula C25H27ClN6O3S and a molecular weight of 527.05 g/mol. Its IUPAC name is 3-[[(6-chloro-3-pyridinyl)methylamino]-(4-methoxyphenyl)sulfinylmethylidene]-4-imino-1-methyl-5a,6,7,8,9,9a-hexahydropyrimido[1,2-a]benzimidazol-2-one.
| Compound Name | 3-[[(6-chloro-3-pyridinyl)methylamino]-(4-methoxyphenyl)sulfinylmethylidene]-4-imino-1-methyl-5a,6,7,8,9,9a-hexahydropyrimido[1,2-a]benzimidazol-2-one |
|---|---|
| PubChem CID | 136628325 |
| Molecular Formula | C25H27ClN6O3S |
| Molecular Weight | 527.05 g/mol |
| Exact Mass | 526.16 |
| IUPAC Name | 3-[[(6-chloro-3-pyridinyl)methylamino]-(4-methoxyphenyl)sulfinylmethylidene]-4-imino-1-methyl-5a,6,7,8,9,9a-hexahydropyrimido[1,2-a]benzimidazol-2-one |
| SMILES | [H]/N=c1/c(=C(NCc2ccc(Cl)nc2)S(=O)c2ccc(OC)cc2)c(=O)n(C)c2n1C1CCCCC1N=2 |
| InChI | InChI=1S/C25H27ClN6O3S/c1-31-24(33)21(22(27)32-19-6-4-3-5-18(19)30-25(31)32)23(29-14-15-7-12-20(26)28-13-15)36(34)17-10-8-16(35-2)9-11-17/h7-13,18-19,27,29H,3-6,14H2,1-2H3/b23-21?,27-22- |
| InChIKey | QACNWADVMFBYJJ-ZDGZPEBPSA-N |
| XLogP | 1.50 |
| TPSA | 114.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.05 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|