C19H19ClN4O4 — CID 136629877
[(Z)-[amino-(4-chloro-1H-pyrrol-2-yl)methylidene]amino] 12-oxo-6,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzoxazepine-9-carboxylate (PubChem CID 136629877) has the molecular formula C19H19ClN4O4 and a molecular weight of 402.84 g/mol. Its IUPAC name is [(Z)-[amino-(4-chloro-1H-pyrrol-2-yl)methylidene]amino] 12-oxo-6,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzoxazepine-9-carboxylate.
| Compound Name | [(Z)-[amino-(4-chloro-1H-pyrrol-2-yl)methylidene]amino] 12-oxo-6,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzoxazepine-9-carboxylate |
|---|---|
| PubChem CID | 136629877 |
| Molecular Formula | C19H19ClN4O4 |
| Molecular Weight | 402.84 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | [(Z)-[amino-(4-chloro-1H-pyrrol-2-yl)methylidene]amino] 12-oxo-6,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzoxazepine-9-carboxylate |
| SMILES | N/C(=N\OC(=O)C1CCC2COc3ccccc3C(=O)N2C1)c1cc(Cl)c[nH]1 |
| InChI | InChI=1S/C19H19ClN4O4/c20-12-7-15(22-8-12)17(21)23-28-19(26)11-5-6-13-10-27-16-4-2-1-3-14(16)18(25)24(13)9-11/h1-4,7-8,11,13,22H,5-6,9-10H2,(H2,21,23) |
| InChIKey | FBZGTYWIXAAWER-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 110.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.84 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|