C19H16N4OS — CID 136639935
3-methyl-4-(3-pyridin-2-yl-4,6,7,8-tetrahydro-[1,2]oxazolo[5,4-e][1,4]thiazepin-4-yl)benzonitrile (PubChem CID 136639935) has the molecular formula C19H16N4OS and a molecular weight of 348.43 g/mol. Its IUPAC name is 3-methyl-4-(3-pyridin-2-yl-4,6,7,8-tetrahydro-[1,2]oxazolo[5,4-e][1,4]thiazepin-4-yl)benzonitrile.
| Compound Name | 3-methyl-4-(3-pyridin-2-yl-4,6,7,8-tetrahydro-[1,2]oxazolo[5,4-e][1,4]thiazepin-4-yl)benzonitrile |
|---|---|
| PubChem CID | 136639935 |
| Molecular Formula | C19H16N4OS |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | 3-methyl-4-(3-pyridin-2-yl-4,6,7,8-tetrahydro-[1,2]oxazolo[5,4-e][1,4]thiazepin-4-yl)benzonitrile |
| SMILES | Cc1cc(C#N)ccc1C1SCCNc2onc(-c3ccccn3)c21 |
| InChI | InChI=1S/C19H16N4OS/c1-12-10-13(11-20)5-6-14(12)18-16-17(15-4-2-3-7-21-15)23-24-19(16)22-8-9-25-18/h2-7,10,18,22H,8-9H2,1H3 |
| InChIKey | YRCQHRYWSVLGEL-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 74.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |