C20H21ClN4S — CID 136640071
(4R,7S)-4-(4-chloro-2-methylphenyl)-1,7-dimethyl-3-pyridin-2-yl-4,6,7,8-tetrahydropyrazolo[5,4-e][1,4]thiazepine (PubChem CID 136640071) has the molecular formula C20H21ClN4S and a molecular weight of 384.94 g/mol. Its IUPAC name is (4R,7S)-4-(4-chloro-2-methylphenyl)-1,7-dimethyl-3-pyridin-2-yl-4,6,7,8-tetrahydropyrazolo[5,4-e][1,4]thiazepine.
| Compound Name | (4R,7S)-4-(4-chloro-2-methylphenyl)-1,7-dimethyl-3-pyridin-2-yl-4,6,7,8-tetrahydropyrazolo[5,4-e][1,4]thiazepine |
|---|---|
| PubChem CID | 136640071 |
| Molecular Formula | C20H21ClN4S |
| Molecular Weight | 384.94 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | (4R,7S)-4-(4-chloro-2-methylphenyl)-1,7-dimethyl-3-pyridin-2-yl-4,6,7,8-tetrahydropyrazolo[5,4-e][1,4]thiazepine |
| SMILES | Cc1cc(Cl)ccc1[C@H]1SC[C@H](C)Nc2c1c(-c1ccccn1)nn2C |
| InChI | InChI=1S/C20H21ClN4S/c1-12-10-14(21)7-8-15(12)19-17-18(16-6-4-5-9-22-16)24-25(3)20(17)23-13(2)11-26-19/h4-10,13,19,23H,11H2,1-3H3/t13-,19+/m0/s1 |
| InChIKey | DAVWSAPQXSFPQJ-ORAYPTAESA-N |
| XLogP | 5.08 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.94 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |