C26H35BrN4OSSi — CID 136640201
[4-(4-bromo-2-methylphenyl)-1-methyl-3-pyridin-2-yl-4,6,7,8-tetrahydropyrazolo[5,4-e][1,4]thiazepin-7-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 136640201) has the molecular formula C26H35BrN4OSSi and a molecular weight of 559.65 g/mol. Its IUPAC name is [4-(4-bromo-2-methylphenyl)-1-methyl-3-pyridin-2-yl-4,6,7,8-tetrahydropyrazolo[5,4-e][1,4]thiazepin-7-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [4-(4-bromo-2-methylphenyl)-1-methyl-3-pyridin-2-yl-4,6,7,8-tetrahydropyrazolo[5,4-e][1,4]thiazepin-7-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 136640201 |
| Molecular Formula | C26H35BrN4OSSi |
| Molecular Weight | 559.65 g/mol |
| Exact Mass | 558.15 |
| IUPAC Name | [4-(4-bromo-2-methylphenyl)-1-methyl-3-pyridin-2-yl-4,6,7,8-tetrahydropyrazolo[5,4-e][1,4]thiazepin-7-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | Cc1cc(Br)ccc1C1SCC(CO[Si](C)(C)C(C)(C)C)Nc2c1c(-c1ccccn1)nn2C |
| InChI | InChI=1S/C26H35BrN4OSSi/c1-17-14-18(27)11-12-20(17)24-22-23(21-10-8-9-13-28-21)30-31(5)25(22)29-19(16-33-24)15-32-34(6,7)26(2,3)4/h8-14,19,24,29H,15-16H2,1-7H3 |
| InChIKey | XSKXZOCUUZILOL-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.65 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|