C20H18BrN5S — CID 136634684
(4S,7R)-4-(4-bromo-2-methylphenyl)-1-methyl-3-pyridin-2-yl-4,6,7,8-tetrahydropyrazolo[5,4-e][1,4]thiazepine-7-carbonitrile (PubChem CID 136634684) has the molecular formula C20H18BrN5S and a molecular weight of 440.37 g/mol. Its IUPAC name is (4S,7R)-4-(4-bromo-2-methylphenyl)-1-methyl-3-pyridin-2-yl-4,6,7,8-tetrahydropyrazolo[5,4-e][1,4]thiazepine-7-carbonitrile.
| Compound Name | (4S,7R)-4-(4-bromo-2-methylphenyl)-1-methyl-3-pyridin-2-yl-4,6,7,8-tetrahydropyrazolo[5,4-e][1,4]thiazepine-7-carbonitrile |
|---|---|
| PubChem CID | 136634684 |
| Molecular Formula | C20H18BrN5S |
| Molecular Weight | 440.37 g/mol |
| Exact Mass | 439.05 |
| IUPAC Name | (4S,7R)-4-(4-bromo-2-methylphenyl)-1-methyl-3-pyridin-2-yl-4,6,7,8-tetrahydropyrazolo[5,4-e][1,4]thiazepine-7-carbonitrile |
| SMILES | Cc1cc(Br)ccc1[C@@H]1SC[C@@H](C#N)Nc2c1c(-c1ccccn1)nn2C |
| InChI | InChI=1S/C20H18BrN5S/c1-12-9-13(21)6-7-15(12)19-17-18(16-5-3-4-8-23-16)25-26(2)20(17)24-14(10-22)11-27-19/h3-9,14,19,24H,11H2,1-2H3/t14-,19+/m1/s1 |
| InChIKey | XVQCVGGLOZSIMA-KUHUBIRLSA-N |
| XLogP | 4.69 |
| TPSA | 66.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.37 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |