C30H41ClN8O3 — CID 136640343
tert-butyl 4-[4-(5-chloro-3-pyridinyl)-6-[(E)-N'-hydroxycarbamimidoyl]-3-[(4-methylcyclohexyl)methyl]imidazo[4,5-c]pyridin-2-yl]-3-methylpiperazine-1-carboxylate (PubChem CID 136640343) has the molecular formula C30H41ClN8O3 and a molecular weight of 597.16 g/mol. Its IUPAC name is tert-butyl 4-[4-(5-chloro-3-pyridinyl)-6-[(E)-N'-hydroxycarbamimidoyl]-3-[(4-methylcyclohexyl)methyl]imidazo[4,5-c]pyridin-2-yl]-3-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-(5-chloro-3-pyridinyl)-6-[(E)-N'-hydroxycarbamimidoyl]-3-[(4-methylcyclohexyl)methyl]imidazo[4,5-c]pyridin-2-yl]-3-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 136640343 |
| Molecular Formula | C30H41ClN8O3 |
| Molecular Weight | 597.16 g/mol |
| Exact Mass | 596.30 |
| IUPAC Name | tert-butyl 4-[4-(5-chloro-3-pyridinyl)-6-[(E)-N'-hydroxycarbamimidoyl]-3-[(4-methylcyclohexyl)methyl]imidazo[4,5-c]pyridin-2-yl]-3-methylpiperazine-1-carboxylate |
| SMILES | CC1CCC(Cn2c(N3CCN(C(=O)OC(C)(C)C)CC3C)nc3cc(/C(N)=N\O)nc(-c4cncc(Cl)c4)c32)CC1 |
| InChI | InChI=1S/C30H41ClN8O3/c1-18-6-8-20(9-7-18)17-39-26-23(13-24(27(32)36-41)34-25(26)21-12-22(31)15-33-14-21)35-28(39)38-11-10-37(16-19(38)2)29(40)42-30(3,4)5/h12-15,18-20,41H,6-11,16-17H2,1-5H3,(H2,32,36) |
| InChIKey | NSUFNTMKGSOEKW-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 134.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.16 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|