About 2-(hydroxymethyl)-5-(3-iodo-4-methoxy-6,7-dihydropyrazolo[5,4-d]pyrimidin-1-yl)oxolan-3-ol
2-(hydroxymethyl)-5-(3-iodo-4-methoxy-6,7-dihydropyrazolo[5,4-d]pyrimidin-1-yl)oxolan-3-ol (PubChem CID 136643003) has the molecular formula C11H15IN4O4
and a molecular weight of 394.17 g/mol. Its IUPAC name is 2-(hydroxymethyl)-5-(3-iodo-4-methoxy-6,7-dihydropyrazolo[5,4-d]pyrimidin-1-yl)oxolan-3-ol.
Molecular Properties
| Compound Name | 2-(hydroxymethyl)-5-(3-iodo-4-methoxy-6,7-dihydropyrazolo[5,4-d]pyrimidin-1-yl)oxolan-3-ol |
| PubChem CID | 136643003 |
| Molecular Formula | C11H15IN4O4 |
| Molecular Weight | 394.17 g/mol |
| Exact Mass | 394.01 |
| IUPAC Name | 2-(hydroxymethyl)-5-(3-iodo-4-methoxy-6,7-dihydropyrazolo[5,4-d]pyrimidin-1-yl)oxolan-3-ol |
| SMILES | COC1=NCNc2c1c(I)nn2C1CC(O)C(CO)O1 |
| InChI | InChI=1S/C11H15IN4O4/c1-19-11-8-9(12)15-16(10(8)13-4-14-11)7-2-5(18)6(3-17)20-7/h5-7,13,17-18H,2-4H2,1H3 |
| InChIKey | VOWMHNPUAXOPGH-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 101.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.17 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-(hydroxymethyl)-5-(3-iodo-4-methoxy-6,7-dihydropyrazolo[5,4-d]pyrimidin-1-yl)oxolan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(hydroxymethyl)-5-(3-iodo-4-methoxy-6,7-dihydropyrazolo[5,4-d]pyrimidin-1-yl)oxolan-3-ol?
The IUPAC name of 2-(hydroxymethyl)-5-(3-iodo-4-methoxy-6,7-dihydropyrazolo[5,4-d]pyrimidin-1-yl)oxolan-3-ol (CID 136643003) is 2-(hydroxymethyl)-5-(3-iodo-4-methoxy-6,7-dihydropyrazolo[5,4-d]pyrimidin-1-yl)oxolan-3-ol.
What is the SMILES notation for 2-(hydroxymethyl)-5-(3-iodo-4-methoxy-6,7-dihydropyrazolo[5,4-d]pyrimidin-1-yl)oxolan-3-ol?
The canonical SMILES for 2-(hydroxymethyl)-5-(3-iodo-4-methoxy-6,7-dihydropyrazolo[5,4-d]pyrimidin-1-yl)oxolan-3-ol is COC1=NCNc2c1c(I)nn2C1CC(O)C(CO)O1.
What is the InChIKey of 2-(hydroxymethyl)-5-(3-iodo-4-methoxy-6,7-dihydropyrazolo[5,4-d]pyrimidin-1-yl)oxolan-3-ol?
The InChIKey is VOWMHNPUAXOPGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15IN4O4/c1-19-11-8-9(12)15-16(10(8)13-4-14-11)7-2-5(18)6(3-17)20-7/h5-7,13,17-18H,2-4H2,1H3.
What are the key properties of 2-(hydroxymethyl)-5-(3-iodo-4-methoxy-6,7-dihydropyrazolo[5,4-d]pyrimidin-1-yl)oxolan-3-ol?
2-(hydroxymethyl)-5-(3-iodo-4-methoxy-6,7-dihydropyrazolo[5,4-d]pyrimidin-1-yl)oxolan-3-ol has a molecular weight of 394.17 g/mol, XLogP of -0.10, 2 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(hydroxymethyl)-5-(3-iodo-4-methoxy-6,7-dihydropyrazolo[5,4-d]pyrimidin-1-yl)oxolan-3-ol is sourced from PubChem (CID 136643003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).