C14H18N3OSi — CID 136644346
CID 136644346 (PubChem CID 136644346) has the molecular formula C14H18N3OSi and a molecular weight of 272.40 g/mol.
| Compound Name | CID 136644346 |
|---|---|
| PubChem CID | 136644346 |
| Molecular Formula | C14H18N3OSi |
| Molecular Weight | 272.40 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | — |
| SMILES | C/C(=N\Cc1ccccc1O[Si](C)C)c1ccn[nH]1 |
| InChI | InChI=1S/C14H18N3OSi/c1-11(13-8-9-16-17-13)15-10-12-6-4-5-7-14(12)18-19(2)3/h4-9H,10H2,1-3H3,(H,16,17)/b15-11+ |
| InChIKey | XTYATCXNGQPSDC-RVDMUPIBSA-N |
| XLogP | 3.05 |
| TPSA | 50.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.40 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|