C20H17N3O4 — CID 136645779
3-ethynyl-6-(4-hydroxyphenyl)-1-(oxan-2-yl)pyrazolo[5,4-b]pyridine-4-carboxylic acid (PubChem CID 136645779) has the molecular formula C20H17N3O4 and a molecular weight of 363.37 g/mol. Its IUPAC name is 3-ethynyl-6-(4-hydroxyphenyl)-1-(oxan-2-yl)pyrazolo[5,4-b]pyridine-4-carboxylic acid.
| Compound Name | 3-ethynyl-6-(4-hydroxyphenyl)-1-(oxan-2-yl)pyrazolo[5,4-b]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 136645779 |
| Molecular Formula | C20H17N3O4 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | 3-ethynyl-6-(4-hydroxyphenyl)-1-(oxan-2-yl)pyrazolo[5,4-b]pyridine-4-carboxylic acid |
| SMILES | C#Cc1nn(C2CCCCO2)c2nc(-c3ccc(O)cc3)cc(C(=O)O)c12 |
| InChI | InChI=1S/C20H17N3O4/c1-2-15-18-14(20(25)26)11-16(12-6-8-13(24)9-7-12)21-19(18)23(22-15)17-5-3-4-10-27-17/h1,6-9,11,17,24H,3-5,10H2,(H,25,26) |
| InChIKey | GTHNEZBXFYSEBF-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 97.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|