C11H8N4S — CID 136650660
4-[2-(1H-indol-2-yl)ethenyl]-1,2,3,5-thiatriazole (PubChem CID 136650660) has the molecular formula C11H8N4S and a molecular weight of 228.28 g/mol. Its IUPAC name is 4-[2-(1H-indol-2-yl)ethenyl]-1,2,3,5-thiatriazole.
| Compound Name | 4-[2-(1H-indol-2-yl)ethenyl]-1,2,3,5-thiatriazole |
|---|---|
| PubChem CID | 136650660 |
| Molecular Formula | C11H8N4S |
| Molecular Weight | 228.28 g/mol |
| Exact Mass | 228.05 |
| IUPAC Name | 4-[2-(1H-indol-2-yl)ethenyl]-1,2,3,5-thiatriazole |
| SMILES | C(=Cc1cc2ccccc2[nH]1)c1nnsn1 |
| InChI | InChI=1S/C11H8N4S/c1-2-4-10-8(3-1)7-9(12-10)5-6-11-13-15-16-14-11/h1-7,12H |
| InChIKey | ODWRHOJFIBZOAT-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.28 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |