C13H10N2S — CID 136504640
3-[2-(1H-indol-2-yl)ethenyl]-1,2-thiazole (PubChem CID 136504640) has the molecular formula C13H10N2S and a molecular weight of 226.30 g/mol. Its IUPAC name is 3-[2-(1H-indol-2-yl)ethenyl]-1,2-thiazole.
| Compound Name | 3-[2-(1H-indol-2-yl)ethenyl]-1,2-thiazole |
|---|---|
| PubChem CID | 136504640 |
| Molecular Formula | C13H10N2S |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | 3-[2-(1H-indol-2-yl)ethenyl]-1,2-thiazole |
| SMILES | C(=Cc1cc2ccccc2[nH]1)c1ccsn1 |
| InChI | InChI=1S/C13H10N2S/c1-2-4-13-10(3-1)9-12(14-13)6-5-11-7-8-16-15-11/h1-9,14H |
| InChIKey | REQVCTQDGLKUCG-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |