About 2-ethenyl-1H-indole;thiophene-2-carbaldehyde
2-ethenyl-1H-indole;thiophene-2-carbaldehyde (PubChem CID 174484056) has the molecular formula C15H13NOS
and a molecular weight of 255.34 g/mol. Its IUPAC name is 2-ethenyl-1H-indole;thiophene-2-carbaldehyde.
Molecular Properties
| Compound Name | 2-ethenyl-1H-indole;thiophene-2-carbaldehyde |
| PubChem CID | 174484056 |
| Molecular Formula | C15H13NOS |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | 2-ethenyl-1H-indole;thiophene-2-carbaldehyde |
| SMILES | C=Cc1cc2ccccc2[nH]1.O=Cc1cccs1 |
| InChI | InChI=1S/C10H9N.C5H4OS/c1-2-9-7-8-5-3-4-6-10(8)11-9;6-4-5-2-1-3-7-5/h2-7,11H,1H2;1-4H |
| InChIKey | NPOLYAWXHPUYCD-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-ethenyl-1H-indole;thiophene-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenyl-1H-indole;thiophene-2-carbaldehyde?
The IUPAC name of 2-ethenyl-1H-indole;thiophene-2-carbaldehyde (CID 174484056) is 2-ethenyl-1H-indole;thiophene-2-carbaldehyde.
What is the SMILES notation for 2-ethenyl-1H-indole;thiophene-2-carbaldehyde?
The canonical SMILES for 2-ethenyl-1H-indole;thiophene-2-carbaldehyde is C=Cc1cc2ccccc2[nH]1.O=Cc1cccs1.
What is the InChIKey of 2-ethenyl-1H-indole;thiophene-2-carbaldehyde?
The InChIKey is NPOLYAWXHPUYCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N.C5H4OS/c1-2-9-7-8-5-3-4-6-10(8)11-9;6-4-5-2-1-3-7-5/h2-7,11H,1H2;1-4H.
What are the key properties of 2-ethenyl-1H-indole;thiophene-2-carbaldehyde?
2-ethenyl-1H-indole;thiophene-2-carbaldehyde has a molecular weight of 255.34 g/mol, XLogP of 4.37, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenyl-1H-indole;thiophene-2-carbaldehyde is sourced from PubChem (CID 174484056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).