C18H11NO2 — CID 175834648
3-(1H-indol-2-ylmethylidene)indene-1,2-dione (PubChem CID 175834648) has the molecular formula C18H11NO2 and a molecular weight of 273.29 g/mol. Its IUPAC name is 3-(1H-indol-2-ylmethylidene)indene-1,2-dione.
| Compound Name | 3-(1H-indol-2-ylmethylidene)indene-1,2-dione |
|---|---|
| PubChem CID | 175834648 |
| Molecular Formula | C18H11NO2 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 3-(1H-indol-2-ylmethylidene)indene-1,2-dione |
| SMILES | O=C1C(=O)c2ccccc2C1=Cc1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C18H11NO2/c20-17-14-7-3-2-6-13(14)15(18(17)21)10-12-9-11-5-1-4-8-16(11)19-12/h1-10,19H |
| InChIKey | QKPOQTSCPFNOKA-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|