C20H18N4O — CID 54025682
N,N-dimethyl-N'-[2-[(2-oxo-1H-indol-3-ylidene)methyl]-1H-indol-5-yl]methanimidamide (PubChem CID 54025682) has the molecular formula C20H18N4O and a molecular weight of 330.39 g/mol. Its IUPAC name is N,N-dimethyl-N'-[2-[(2-oxo-1H-indol-3-ylidene)methyl]-1H-indol-5-yl]methanimidamide.
| Compound Name | N,N-dimethyl-N'-[2-[(2-oxo-1H-indol-3-ylidene)methyl]-1H-indol-5-yl]methanimidamide |
|---|---|
| PubChem CID | 54025682 |
| Molecular Formula | C20H18N4O |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | N,N-dimethyl-N'-[2-[(2-oxo-1H-indol-3-ylidene)methyl]-1H-indol-5-yl]methanimidamide |
| SMILES | CN(C)/C=N/c1ccc2[nH]c(C=C3C(=O)Nc4ccccc43)cc2c1 |
| InChI | InChI=1S/C20H18N4O/c1-24(2)12-21-14-7-8-18-13(9-14)10-15(22-18)11-17-16-5-3-4-6-19(16)23-20(17)25/h3-12,22H,1-2H3,(H,23,25)/b17-11?,21-12+ |
| InChIKey | LBZSNUJIJLQTTC-MUMVNLODSA-N |
| XLogP | 3.88 |
| TPSA | 60.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|