C12H7F6NO4S2 — CID 87352678
2-[2,2-bis(trifluoromethylsulfonyl)ethenyl]-1H-indole (PubChem CID 87352678) has the molecular formula C12H7F6NO4S2 and a molecular weight of 407.31 g/mol. Its IUPAC name is 2-[2,2-bis(trifluoromethylsulfonyl)ethenyl]-1H-indole.
| Compound Name | 2-[2,2-bis(trifluoromethylsulfonyl)ethenyl]-1H-indole |
|---|---|
| PubChem CID | 87352678 |
| Molecular Formula | C12H7F6NO4S2 |
| Molecular Weight | 407.31 g/mol |
| Exact Mass | 406.97 |
| IUPAC Name | 2-[2,2-bis(trifluoromethylsulfonyl)ethenyl]-1H-indole |
| SMILES | O=S(=O)(C(=Cc1cc2ccccc2[nH]1)S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H7F6NO4S2/c13-11(14,15)24(20,21)10(25(22,23)12(16,17)18)6-8-5-7-3-1-2-4-9(7)19-8/h1-6,19H |
| InChIKey | FXHQPQPFGCNEEC-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 84.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.31 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |