C10H7ClF3NO2S — CID 150326829
2-(2-chloro-1,1,2-trifluoroethyl)sulfonyl-1H-indole (PubChem CID 150326829) has the molecular formula C10H7ClF3NO2S and a molecular weight of 297.69 g/mol. Its IUPAC name is 2-(2-chloro-1,1,2-trifluoroethyl)sulfonyl-1H-indole.
| Compound Name | 2-(2-chloro-1,1,2-trifluoroethyl)sulfonyl-1H-indole |
|---|---|
| PubChem CID | 150326829 |
| Molecular Formula | C10H7ClF3NO2S |
| Molecular Weight | 297.69 g/mol |
| Exact Mass | 296.98 |
| IUPAC Name | 2-(2-chloro-1,1,2-trifluoroethyl)sulfonyl-1H-indole |
| SMILES | O=S(=O)(c1cc2ccccc2[nH]1)C(F)(F)C(F)Cl |
| InChI | InChI=1S/C10H7ClF3NO2S/c11-9(12)10(13,14)18(16,17)8-5-6-3-1-2-4-7(6)15-8/h1-5,9,15H |
| InChIKey | GOVCKPVZSWUSNK-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.69 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|