About 9H-carbazole;thiophene-2-carbaldehyde
9H-carbazole;thiophene-2-carbaldehyde (PubChem CID 174706827) has the molecular formula C17H13NOS
and a molecular weight of 279.36 g/mol. Its IUPAC name is 9H-carbazole;thiophene-2-carbaldehyde.
Molecular Properties
| Compound Name | 9H-carbazole;thiophene-2-carbaldehyde |
| PubChem CID | 174706827 |
| Molecular Formula | C17H13NOS |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 9H-carbazole;thiophene-2-carbaldehyde |
| SMILES | O=Cc1cccs1.c1ccc2c(c1)[nH]c1ccccc12 |
| InChI | InChI=1S/C12H9N.C5H4OS/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;6-4-5-2-1-3-7-5/h1-8,13H;1-4H |
| InChIKey | CKIATIQOAHHEMQ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 9H-carbazole;thiophene-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-carbazole;thiophene-2-carbaldehyde?
The IUPAC name of 9H-carbazole;thiophene-2-carbaldehyde (CID 174706827) is 9H-carbazole;thiophene-2-carbaldehyde.
What is the SMILES notation for 9H-carbazole;thiophene-2-carbaldehyde?
The canonical SMILES for 9H-carbazole;thiophene-2-carbaldehyde is O=Cc1cccs1.c1ccc2c(c1)[nH]c1ccccc12.
What is the InChIKey of 9H-carbazole;thiophene-2-carbaldehyde?
The InChIKey is CKIATIQOAHHEMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9N.C5H4OS/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;6-4-5-2-1-3-7-5/h1-8,13H;1-4H.
What are the key properties of 9H-carbazole;thiophene-2-carbaldehyde?
9H-carbazole;thiophene-2-carbaldehyde has a molecular weight of 279.36 g/mol, XLogP of 4.88, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-carbazole;thiophene-2-carbaldehyde is sourced from PubChem (CID 174706827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).