About 9H-carbazole;thiophen-2-ol
9H-carbazole;thiophen-2-ol (PubChem CID 154941484) has the molecular formula C16H13NOS
and a molecular weight of 267.35 g/mol. Its IUPAC name is 9H-carbazole;thiophen-2-ol.
Molecular Properties
| Compound Name | 9H-carbazole;thiophen-2-ol |
| PubChem CID | 154941484 |
| Molecular Formula | C16H13NOS |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 9H-carbazole;thiophen-2-ol |
| SMILES | Oc1cccs1.c1ccc2c(c1)[nH]c1ccccc12 |
| InChI | InChI=1S/C12H9N.C4H4OS/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;5-4-2-1-3-6-4/h1-8,13H;1-3,5H |
| InChIKey | HIOHESYHRWFABC-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9H-carbazole;thiophen-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-carbazole;thiophen-2-ol?
The IUPAC name of 9H-carbazole;thiophen-2-ol (CID 154941484) is 9H-carbazole;thiophen-2-ol.
What is the SMILES notation for 9H-carbazole;thiophen-2-ol?
The canonical SMILES for 9H-carbazole;thiophen-2-ol is Oc1cccs1.c1ccc2c(c1)[nH]c1ccccc12.
What is the InChIKey of 9H-carbazole;thiophen-2-ol?
The InChIKey is HIOHESYHRWFABC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9N.C4H4OS/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;5-4-2-1-3-6-4/h1-8,13H;1-3,5H.
What are the key properties of 9H-carbazole;thiophen-2-ol?
9H-carbazole;thiophen-2-ol has a molecular weight of 267.35 g/mol, XLogP of 4.77, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-carbazole;thiophen-2-ol is sourced from PubChem (CID 154941484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).