C7H6N4S — CID 67417521
3-[2-(1H-1,2,4-triazol-5-yl)ethenyl]-1,2-thiazole (PubChem CID 67417521) has the molecular formula C7H6N4S and a molecular weight of 178.22 g/mol. Its IUPAC name is 3-[2-(1H-1,2,4-triazol-5-yl)ethenyl]-1,2-thiazole.
| Compound Name | 3-[2-(1H-1,2,4-triazol-5-yl)ethenyl]-1,2-thiazole |
|---|---|
| PubChem CID | 67417521 |
| Molecular Formula | C7H6N4S |
| Molecular Weight | 178.22 g/mol |
| Exact Mass | 178.03 |
| IUPAC Name | 3-[2-(1H-1,2,4-triazol-5-yl)ethenyl]-1,2-thiazole |
| SMILES | C(=Cc1ncn[nH]1)c1ccsn1 |
| InChI | InChI=1S/C7H6N4S/c1(6-3-4-12-11-6)2-7-8-5-9-10-7/h1-5H,(H,8,9,10) |
| InChIKey | VXBFWGZTEGISME-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.22 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |