About 3-[2-(1H-1,2,4-triazol-5-yl)ethenyl]-1,2,5-oxadiazole
3-[2-(1H-1,2,4-triazol-5-yl)ethenyl]-1,2,5-oxadiazole (PubChem CID 67416642) has the molecular formula C6H5N5O
and a molecular weight of 163.14 g/mol. Its IUPAC name is 3-[2-(1H-1,2,4-triazol-5-yl)ethenyl]-1,2,5-oxadiazole.
Analyze 3-[2-(1H-1,2,4-triazol-5-yl)ethenyl]-1,2,5-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(1H-1,2,4-triazol-5-yl)ethenyl]-1,2,5-oxadiazole?
The IUPAC name of 3-[2-(1H-1,2,4-triazol-5-yl)ethenyl]-1,2,5-oxadiazole (CID 67416642) is 3-[2-(1H-1,2,4-triazol-5-yl)ethenyl]-1,2,5-oxadiazole.
What is the SMILES notation for 3-[2-(1H-1,2,4-triazol-5-yl)ethenyl]-1,2,5-oxadiazole?
The canonical SMILES for 3-[2-(1H-1,2,4-triazol-5-yl)ethenyl]-1,2,5-oxadiazole is C(=Cc1ncn[nH]1)c1cnon1.
What is the InChIKey of 3-[2-(1H-1,2,4-triazol-5-yl)ethenyl]-1,2,5-oxadiazole?
The InChIKey is FDBPCQNATWUBJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N5O/c1(5-3-9-12-11-5)2-6-7-4-8-10-6/h1-4H,(H,7,8,10).
What are the key properties of 3-[2-(1H-1,2,4-triazol-5-yl)ethenyl]-1,2,5-oxadiazole?
3-[2-(1H-1,2,4-triazol-5-yl)ethenyl]-1,2,5-oxadiazole has a molecular weight of 163.14 g/mol, XLogP of 0.36, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(1H-1,2,4-triazol-5-yl)ethenyl]-1,2,5-oxadiazole is sourced from PubChem (CID 67416642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).