C19H16N3O4+ — CID 136650951
6-(3,4-dihydroxyphenyl)-8-(4-hydroxyphenyl)-7-methyl-2H-imidazo[1,2-a]pyrazin-7-ium-3-one (PubChem CID 136650951) has the molecular formula C19H16N3O4+ and a molecular weight of 350.35 g/mol. Its IUPAC name is 6-(3,4-dihydroxyphenyl)-8-(4-hydroxyphenyl)-7-methyl-2H-imidazo[1,2-a]pyrazin-7-ium-3-one.
| Compound Name | 6-(3,4-dihydroxyphenyl)-8-(4-hydroxyphenyl)-7-methyl-2H-imidazo[1,2-a]pyrazin-7-ium-3-one |
|---|---|
| PubChem CID | 136650951 |
| Molecular Formula | C19H16N3O4+ |
| Molecular Weight | 350.35 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | 6-(3,4-dihydroxyphenyl)-8-(4-hydroxyphenyl)-7-methyl-2H-imidazo[1,2-a]pyrazin-7-ium-3-one |
| SMILES | C[N+]1=C(c2ccc(O)cc2)C2=NCC(=O)N2C=C1c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C19H15N3O4/c1-21-14(12-4-7-15(24)16(25)8-12)10-22-17(26)9-20-19(22)18(21)11-2-5-13(23)6-3-11/h2-8,10H,9H2,1H3,(H2,20,23,24,25)/p+1 |
| InChIKey | OOOAXOQOHHUBHR-UHFFFAOYSA-O |
| XLogP | 1.49 |
| TPSA | 96.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.35 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|