C5H3Cl5F3NOP- — CID 136654291
pentachloro-λ5-phosphane;(4,4,4-trifluoro-2-methyl-3-oxobut-1-enylidene)azanide (PubChem CID 136654291) has the molecular formula C5H3Cl5F3NOP- and a molecular weight of 358.32 g/mol. Its IUPAC name is pentachloro-λ5-phosphane;(4,4,4-trifluoro-2-methyl-3-oxobut-1-enylidene)azanide.
| Compound Name | pentachloro-λ5-phosphane;(4,4,4-trifluoro-2-methyl-3-oxobut-1-enylidene)azanide |
|---|---|
| PubChem CID | 136654291 |
| Molecular Formula | C5H3Cl5F3NOP- |
| Molecular Weight | 358.32 g/mol |
| Exact Mass | 355.84 |
| IUPAC Name | pentachloro-λ5-phosphane;(4,4,4-trifluoro-2-methyl-3-oxobut-1-enylidene)azanide |
| SMILES | CC(=C=[N-])C(=O)C(F)(F)F.ClP(Cl)(Cl)(Cl)Cl |
| InChI | InChI=1S/C5H3F3NO.Cl5P/c1-3(2-9)4(10)5(6,7)8;1-6(2,3,4)5/h1H3;/q-1; |
| InChIKey | NDTGWNBKIWIFLO-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 39.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.32 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|