C28H27N5O2 — CID 136654560
2-butyl-6,7-bis(pyridin-2-ylmethylimino)benzo[de]isoquinoline-1,3-diol (PubChem CID 136654560) has the molecular formula C28H27N5O2 and a molecular weight of 465.56 g/mol. Its IUPAC name is 2-butyl-6,7-bis(pyridin-2-ylmethylimino)benzo[de]isoquinoline-1,3-diol.
| Compound Name | 2-butyl-6,7-bis(pyridin-2-ylmethylimino)benzo[de]isoquinoline-1,3-diol |
|---|---|
| PubChem CID | 136654560 |
| Molecular Formula | C28H27N5O2 |
| Molecular Weight | 465.56 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | 2-butyl-6,7-bis(pyridin-2-ylmethylimino)benzo[de]isoquinoline-1,3-diol |
| SMILES | CCCCn1c(O)c2cc/c(=N\Cc3ccccn3)c3/c(=N/Cc4ccccn4)ccc(c1O)c23 |
| InChI | InChI=1S/C28H27N5O2/c1-2-3-16-33-27(34)21-10-12-23(31-17-19-8-4-6-14-29-19)26-24(13-11-22(25(21)26)28(33)35)32-18-20-9-5-7-15-30-20/h4-15,34-35H,2-3,16-18H2,1H3/b31-23+,32-24+ |
| InChIKey | MDNAVYBNZBFHKA-QBRCKEFASA-N |
| XLogP | 4.44 |
| TPSA | 95.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.56 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_6_pyridone_OH(5)', 'substructure': 'N/A'} |
|---|