C40H44N4O4 — CID 136656349
8,19-dihydroxy-14,26-bis(octylimino)-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1,3,5(25),8,10,12,15,19,21,23-decaene-6,17-dione (PubChem CID 136656349) has the molecular formula C40H44N4O4 and a molecular weight of 644.82 g/mol. Its IUPAC name is 8,19-dihydroxy-14,26-bis(octylimino)-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1,3,5(25),8,10,12,15,19,21,23-decaene-6,17-dione.
| Compound Name | 8,19-dihydroxy-14,26-bis(octylimino)-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1,3,5(25),8,10,12,15,19,21,23-decaene-6,17-dione |
|---|---|
| PubChem CID | 136656349 |
| Molecular Formula | C40H44N4O4 |
| Molecular Weight | 644.82 g/mol |
| Exact Mass | 644.34 |
| IUPAC Name | 8,19-dihydroxy-14,26-bis(octylimino)-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1,3,5(25),8,10,12,15,19,21,23-decaene-6,17-dione |
| SMILES | CCCCCCCC/N=c1\cc2c(=O)[nH]c(O)c3ccc4c5/c(=N/CCCCCCCC)cc6c(=O)[nH]c(O)c7ccc(c1c4c32)c5c76 |
| InChI | InChI=1S/C40H44N4O4/c1-3-5-7-9-11-13-19-41-29-21-27-31-25(37(45)43-39(27)47)18-16-24-34-30(42-20-14-12-10-8-6-4-2)22-28-32-26(38(46)44-40(28)48)17-15-23(36(32)34)33(29)35(24)31/h15-18,21-22,45-46H,3-14,19-20H2,1-2H3,(H,43,47)(H,44,48)/b41-29+,42-30+ |
| InChIKey | LXDPRADOPXNSGT-ZOZONKMWSA-N |
| XLogP | 8.23 |
| TPSA | 130.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.82 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|