C19H16N2O5 — CID 69115719
13-(5-hydroxypentyl)-5,11-diazatetracyclo[7.3.2.23,7.02,8]hexadeca-1(13),2,7,9(14),15-pentaene-4,6,10,12-tetrone (PubChem CID 69115719) has the molecular formula C19H16N2O5 and a molecular weight of 352.35 g/mol. Its IUPAC name is 13-(5-hydroxypentyl)-5,11-diazatetracyclo[7.3.2.23,7.02,8]hexadeca-1(13),2,7,9(14),15-pentaene-4,6,10,12-tetrone.
| Compound Name | 13-(5-hydroxypentyl)-5,11-diazatetracyclo[7.3.2.23,7.02,8]hexadeca-1(13),2,7,9(14),15-pentaene-4,6,10,12-tetrone |
|---|---|
| PubChem CID | 69115719 |
| Molecular Formula | C19H16N2O5 |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 13-(5-hydroxypentyl)-5,11-diazatetracyclo[7.3.2.23,7.02,8]hexadeca-1(13),2,7,9(14),15-pentaene-4,6,10,12-tetrone |
| SMILES | O=c1[nH]c(=O)c2ccc1c1c3cc(CCCCCO)c(c(=O)[nH]c3=O)c21 |
| InChI | InChI=1S/C19H16N2O5/c22-7-3-1-2-4-9-8-12-14-10-5-6-11(17(24)20-16(10)23)15(14)13(9)19(26)21-18(12)25/h5-6,8,22H,1-4,7H2,(H,20,23,24)(H,21,25,26) |
| InChIKey | GIDYZFKKSFKBPJ-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 120.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|