C21H26N2O3 — CID 136656555
2-(C,N-dimethylcarbonimidoyl)-3-[2-[1-(2-ethoxy-6-hydroxyphenyl)ethylideneamino]ethyl]phenol (PubChem CID 136656555) has the molecular formula C21H26N2O3 and a molecular weight of 354.45 g/mol. Its IUPAC name is 2-(C,N-dimethylcarbonimidoyl)-3-[2-[1-(2-ethoxy-6-hydroxyphenyl)ethylideneamino]ethyl]phenol.
| Compound Name | 2-(C,N-dimethylcarbonimidoyl)-3-[2-[1-(2-ethoxy-6-hydroxyphenyl)ethylideneamino]ethyl]phenol |
|---|---|
| PubChem CID | 136656555 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | 2-(C,N-dimethylcarbonimidoyl)-3-[2-[1-(2-ethoxy-6-hydroxyphenyl)ethylideneamino]ethyl]phenol |
| SMILES | CCOc1cccc(O)c1/C(C)=N/CCc1cccc(O)c1/C(C)=N/C |
| InChI | InChI=1S/C21H26N2O3/c1-5-26-19-11-7-10-18(25)21(19)15(3)23-13-12-16-8-6-9-17(24)20(16)14(2)22-4/h6-11,24-25H,5,12-13H2,1-4H3/b22-14+,23-15+ |
| InChIKey | ARKCOVJXQDGXNU-HOFJZWJUSA-N |
| XLogP | 3.99 |
| TPSA | 74.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|