C25H27N3O4Si — CID 136659905
5-benzoyl-1-phenyl-7H-pyrazolo[5,4-b]pyridin-4-one;1-methoxyethenoxy(trimethyl)silane (PubChem CID 136659905) has the molecular formula C25H27N3O4Si and a molecular weight of 461.59 g/mol. Its IUPAC name is 5-benzoyl-1-phenyl-7H-pyrazolo[5,4-b]pyridin-4-one;1-methoxyethenoxy(trimethyl)silane.
| Compound Name | 5-benzoyl-1-phenyl-7H-pyrazolo[5,4-b]pyridin-4-one;1-methoxyethenoxy(trimethyl)silane |
|---|---|
| PubChem CID | 136659905 |
| Molecular Formula | C25H27N3O4Si |
| Molecular Weight | 461.59 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | 5-benzoyl-1-phenyl-7H-pyrazolo[5,4-b]pyridin-4-one;1-methoxyethenoxy(trimethyl)silane |
| SMILES | C=C(OC)O[Si](C)(C)C.O=C(c1ccccc1)c1c[nH]c2c(cnn2-c2ccccc2)c1=O |
| InChI | InChI=1S/C19H13N3O2.C6H14O2Si/c23-17(13-7-3-1-4-8-13)15-11-20-19-16(18(15)24)12-21-22(19)14-9-5-2-6-10-14;1-6(7-2)8-9(3,4)5/h1-12H,(H,20,24);1H2,2-5H3 |
| InChIKey | HGJHZWLFBPDMQV-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 86.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.59 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|