C14H16N4O2 — CID 136660737
ethane;6-(2-methylphenyl)-4H-[1,2,4]triazolo[1,5-a]pyrimidine-5,7-dione (PubChem CID 136660737) has the molecular formula C14H16N4O2 and a molecular weight of 272.31 g/mol. Its IUPAC name is ethane;6-(2-methylphenyl)-4H-[1,2,4]triazolo[1,5-a]pyrimidine-5,7-dione.
| Compound Name | ethane;6-(2-methylphenyl)-4H-[1,2,4]triazolo[1,5-a]pyrimidine-5,7-dione |
|---|---|
| PubChem CID | 136660737 |
| Molecular Formula | C14H16N4O2 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | ethane;6-(2-methylphenyl)-4H-[1,2,4]triazolo[1,5-a]pyrimidine-5,7-dione |
| SMILES | CC.Cc1ccccc1C1C(=O)Nc2ncnn2C1=O |
| InChI | InChI=1S/C12H10N4O2.C2H6/c1-7-4-2-3-5-8(7)9-10(17)15-12-13-6-14-16(12)11(9)18;1-2/h2-6,9H,1H3,(H,13,14,15,17);1-2H3 |
| InChIKey | MGECCMQFHZRHOB-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|