C11H9NO2S — CID 21486134
3-(2-methylphenyl)-4-sulfanylidenepyrrolidine-2,5-dione (PubChem CID 21486134) has the molecular formula C11H9NO2S and a molecular weight of 219.26 g/mol. Its IUPAC name is 3-(2-methylphenyl)-4-sulfanylidenepyrrolidine-2,5-dione.
| Compound Name | 3-(2-methylphenyl)-4-sulfanylidenepyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 21486134 |
| Molecular Formula | C11H9NO2S |
| Molecular Weight | 219.26 g/mol |
| Exact Mass | 219.04 |
| IUPAC Name | 3-(2-methylphenyl)-4-sulfanylidenepyrrolidine-2,5-dione |
| SMILES | Cc1ccccc1C1C(=O)NC(=O)C1=S |
| InChI | InChI=1S/C11H9NO2S/c1-6-4-2-3-5-7(6)8-9(15)11(14)12-10(8)13/h2-5,8H,1H3,(H,12,13,14) |
| InChIKey | WXGQVHFYDDWGAX-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.26 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|