C15H17N3O2 — CID 79501230
5-(2-methylphenyl)-2-pyrrolidin-2-yl-1H-pyrimidine-4,6-dione (PubChem CID 79501230) has the molecular formula C15H17N3O2 and a molecular weight of 271.32 g/mol. Its IUPAC name is 5-(2-methylphenyl)-2-pyrrolidin-2-yl-1H-pyrimidine-4,6-dione.
| Compound Name | 5-(2-methylphenyl)-2-pyrrolidin-2-yl-1H-pyrimidine-4,6-dione |
|---|---|
| PubChem CID | 79501230 |
| Molecular Formula | C15H17N3O2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | 5-(2-methylphenyl)-2-pyrrolidin-2-yl-1H-pyrimidine-4,6-dione |
| SMILES | Cc1ccccc1C1C(=O)N=C(C2CCCN2)NC1=O |
| InChI | InChI=1S/C15H17N3O2/c1-9-5-2-3-6-10(9)12-14(19)17-13(18-15(12)20)11-7-4-8-16-11/h2-3,5-6,11-12,16H,4,7-8H2,1H3,(H,17,18,19,20) |
| InChIKey | SWGFZSDNUJRYMY-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|