C34H30F10NiO4 — CID 136663396
bis((3-hydroxy-4,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl)-(2,3,4,5,6-pentafluorophenyl)methanone);nickel (PubChem CID 136663396) has the molecular formula C34H30F10NiO4 and a molecular weight of 751.28 g/mol. Its IUPAC name is bis((3-hydroxy-4,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl)-(2,3,4,5,6-pentafluorophenyl)methanone);nickel.
| Compound Name | bis((3-hydroxy-4,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl)-(2,3,4,5,6-pentafluorophenyl)methanone);nickel |
|---|---|
| PubChem CID | 136663396 |
| Molecular Formula | C34H30F10NiO4 |
| Molecular Weight | 751.28 g/mol |
| Exact Mass | 750.13 |
| IUPAC Name | bis((3-hydroxy-4,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl)-(2,3,4,5,6-pentafluorophenyl)methanone);nickel |
| SMILES | CC12CCC(C(C(=O)c3c(F)c(F)c(F)c(F)c3F)=C1O)C2(C)C.CC12CCC(C(C(=O)c3c(F)c(F)c(F)c(F)c3F)=C1O)C2(C)C.[Ni] |
| InChI | InChI=1S/2C17H15F5O2.Ni/c2*1-16(2)6-4-5-17(16,3)15(24)7(6)14(23)8-9(18)11(20)13(22)12(21)10(8)19;/h2*6,24H,4-5H2,1-3H3; |
| InChIKey | YJWNOHZYEWVBTI-UHFFFAOYSA-N |
| XLogP | 9.66 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.28 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|