C16H15F5O — CID 54759919
(2,3,4,5,6-pentafluorophenyl)-(2,6,6-trimethylcyclohexen-1-yl)methanone (PubChem CID 54759919) has the molecular formula C16H15F5O and a molecular weight of 318.29 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl)-(2,6,6-trimethylcyclohexen-1-yl)methanone.
| Compound Name | (2,3,4,5,6-pentafluorophenyl)-(2,6,6-trimethylcyclohexen-1-yl)methanone |
|---|---|
| PubChem CID | 54759919 |
| Molecular Formula | C16H15F5O |
| Molecular Weight | 318.29 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl)-(2,6,6-trimethylcyclohexen-1-yl)methanone |
| SMILES | CC1=C(C(=O)c2c(F)c(F)c(F)c(F)c2F)C(C)(C)CCC1 |
| InChI | InChI=1S/C16H15F5O/c1-7-5-4-6-16(2,3)9(7)15(22)8-10(17)12(19)14(21)13(20)11(8)18/h4-6H2,1-3H3 |
| InChIKey | CSDQMMRUYMNNTF-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.29 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|