About bis[4-oxo-4-(2,6,6-trimethylcyclohexen-1-yl)butan-2-yl] butanedioate
bis[4-oxo-4-(2,6,6-trimethylcyclohexen-1-yl)butan-2-yl] butanedioate (PubChem CID 91469127) has the molecular formula C30H46O6
and a molecular weight of 502.69 g/mol. Its IUPAC name is bis[4-oxo-4-(2,6,6-trimethylcyclohexen-1-yl)butan-2-yl] butanedioate.
Molecular Properties
| Compound Name | bis[4-oxo-4-(2,6,6-trimethylcyclohexen-1-yl)butan-2-yl] butanedioate |
| PubChem CID | 91469127 |
| Molecular Formula | C30H46O6 |
| Molecular Weight | 502.69 g/mol |
| Exact Mass | 502.33 |
| IUPAC Name | bis[4-oxo-4-(2,6,6-trimethylcyclohexen-1-yl)butan-2-yl] butanedioate |
| SMILES | CC1=C(C(=O)CC(C)OC(=O)CCC(=O)OC(C)CC(=O)C2=C(C)CCCC2(C)C)C(C)(C)CCC1 |
| InChI | InChI=1S/C30H46O6/c1-19-11-9-15-29(5,6)27(19)23(31)17-21(3)35-25(33)13-14-26(34)36-22(4)18-24(32)28-20(2)12-10-16-30(28,7)8/h21-22H,9-18H2,1-8H3 |
| InChIKey | XLVNFNJCYOUCCW-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 502.69 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze bis[4-oxo-4-(2,6,6-trimethylcyclohexen-1-yl)butan-2-yl] butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[4-oxo-4-(2,6,6-trimethylcyclohexen-1-yl)butan-2-yl] butanedioate?
The IUPAC name of bis[4-oxo-4-(2,6,6-trimethylcyclohexen-1-yl)butan-2-yl] butanedioate (CID 91469127) is bis[4-oxo-4-(2,6,6-trimethylcyclohexen-1-yl)butan-2-yl] butanedioate.
What is the SMILES notation for bis[4-oxo-4-(2,6,6-trimethylcyclohexen-1-yl)butan-2-yl] butanedioate?
The canonical SMILES for bis[4-oxo-4-(2,6,6-trimethylcyclohexen-1-yl)butan-2-yl] butanedioate is CC1=C(C(=O)CC(C)OC(=O)CCC(=O)OC(C)CC(=O)C2=C(C)CCCC2(C)C)C(C)(C)CCC1.
What is the InChIKey of bis[4-oxo-4-(2,6,6-trimethylcyclohexen-1-yl)butan-2-yl] butanedioate?
The InChIKey is XLVNFNJCYOUCCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H46O6/c1-19-11-9-15-29(5,6)27(19)23(31)17-21(3)35-25(33)13-14-26(34)36-22(4)18-24(32)28-20(2)12-10-16-30(28,7)8/h21-22H,9-18H2,1-8H3.
What are the key properties of bis[4-oxo-4-(2,6,6-trimethylcyclohexen-1-yl)butan-2-yl] butanedioate?
bis[4-oxo-4-(2,6,6-trimethylcyclohexen-1-yl)butan-2-yl] butanedioate has a molecular weight of 502.69 g/mol, XLogP of 6.60, 11 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis[4-oxo-4-(2,6,6-trimethylcyclohexen-1-yl)butan-2-yl] butanedioate is sourced from PubChem (CID 91469127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).