C18H32OS — CID 123803776
3-pentylsulfanyl-1-(2,6,6-trimethylcyclohexen-1-yl)butan-1-one (PubChem CID 123803776) has the molecular formula C18H32OS and a molecular weight of 296.52 g/mol. Its IUPAC name is 3-pentylsulfanyl-1-(2,6,6-trimethylcyclohexen-1-yl)butan-1-one.
| Compound Name | 3-pentylsulfanyl-1-(2,6,6-trimethylcyclohexen-1-yl)butan-1-one |
|---|---|
| PubChem CID | 123803776 |
| Molecular Formula | C18H32OS |
| Molecular Weight | 296.52 g/mol |
| Exact Mass | 296.22 |
| IUPAC Name | 3-pentylsulfanyl-1-(2,6,6-trimethylcyclohexen-1-yl)butan-1-one |
| SMILES | CCCCCSC(C)CC(=O)C1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C18H32OS/c1-6-7-8-12-20-15(3)13-16(19)17-14(2)10-9-11-18(17,4)5/h15H,6-13H2,1-5H3 |
| InChIKey | JDRZHUGGGQMZDN-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.52 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|