C17H23NO3 — CID 173345906
8-amino-8-oxo-6-(2,6,6-trimethylcyclohexen-1-yl)octa-2,4,6-trienoic acid (PubChem CID 173345906) has the molecular formula C17H23NO3 and a molecular weight of 289.38 g/mol. Its IUPAC name is 8-amino-8-oxo-6-(2,6,6-trimethylcyclohexen-1-yl)octa-2,4,6-trienoic acid.
| Compound Name | 8-amino-8-oxo-6-(2,6,6-trimethylcyclohexen-1-yl)octa-2,4,6-trienoic acid |
|---|---|
| PubChem CID | 173345906 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 8-amino-8-oxo-6-(2,6,6-trimethylcyclohexen-1-yl)octa-2,4,6-trienoic acid |
| SMILES | CC1=C(C(C=CC=CC(=O)O)=CC(N)=O)C(C)(C)CCC1 |
| InChI | InChI=1S/C17H23NO3/c1-12-7-6-10-17(2,3)16(12)13(11-14(18)19)8-4-5-9-15(20)21/h4-5,8-9,11H,6-7,10H2,1-3H3,(H2,18,19)(H,20,21) |
| InChIKey | WWSPOSHKYHBSRW-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|